C8H14N2S — CID 24839030
4-pentyl-1,3-dihydroimidazole-2-thione (PubChem CID 24839030) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 4-pentyl-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-pentyl-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 24839030 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 4-pentyl-1,3-dihydroimidazole-2-thione |
| SMILES | CCCCCc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C8H14N2S/c1-2-3-4-5-7-6-9-8(11)10-7/h6H,2-5H2,1H3,(H2,9,10,11) |
| InChIKey | QEGNZISTPQZCHR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|