About potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride
potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride (PubChem CID 174967968) has the molecular formula C17H33KO4
and a molecular weight of 340.55 g/mol. Its IUPAC name is potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride.
Molecular Properties
| Compound Name | potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride |
| PubChem CID | 174967968 |
| Molecular Formula | C17H33KO4 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride |
| SMILES | CCCCCCCCC(CC(C(=O)O)C(=O)O)C(C)(C)C.[H-].[K+] |
| InChI | InChI=1S/C17H32O4.K.H/c1-5-6-7-8-9-10-11-13(17(2,3)4)12-14(15(18)19)16(20)21;;/h13-14H,5-12H2,1-4H3,(H,18,19)(H,20,21);;/q;+1;-1 |
| InChIKey | SGWNFAMRYCBJKI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride?
The IUPAC name of potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride (CID 174967968) is potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride.
What is the SMILES notation for potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride?
The canonical SMILES for potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride is CCCCCCCCC(CC(C(=O)O)C(=O)O)C(C)(C)C.[H-].[K+].
What is the InChIKey of potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride?
The InChIKey is SGWNFAMRYCBJKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O4.K.H/c1-5-6-7-8-9-10-11-13(17(2,3)4)12-14(15(18)19)16(20)21;;/h13-14H,5-12H2,1-4H3,(H,18,19)(H,20,21);;/q;+1;-1.
What are the key properties of potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride?
potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride has a molecular weight of 340.55 g/mol, XLogP of 1.69, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-(2-tert-butyldecyl)propanedioic acid;hydride is sourced from PubChem (CID 174967968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).