C31H28O2S — CID 174968120
(3,4-dimethylphenyl)-phenylmethanone;2-propan-2-ylthioxanthen-9-one (PubChem CID 174968120) has the molecular formula C31H28O2S and a molecular weight of 464.63 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-phenylmethanone;2-propan-2-ylthioxanthen-9-one.
| Compound Name | (3,4-dimethylphenyl)-phenylmethanone;2-propan-2-ylthioxanthen-9-one |
|---|---|
| PubChem CID | 174968120 |
| Molecular Formula | C31H28O2S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (3,4-dimethylphenyl)-phenylmethanone;2-propan-2-ylthioxanthen-9-one |
| SMILES | CC(C)c1ccc2sc3ccccc3c(=O)c2c1.Cc1ccc(C(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C16H14OS.C15H14O/c1-10(2)11-7-8-15-13(9-11)16(17)12-5-3-4-6-14(12)18-15;1-11-8-9-14(10-12(11)2)15(16)13-6-4-3-5-7-13/h3-10H,1-2H3;3-10H,1-2H3 |
| InChIKey | YMJVWKRFWNEZTL-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|