About butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride
butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride (PubChem CID 174969617) has the molecular formula C12H30FNO3S
and a molecular weight of 287.44 g/mol. Its IUPAC name is butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride.
Molecular Properties
| Compound Name | butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride |
| PubChem CID | 174969617 |
| Molecular Formula | C12H30FNO3S |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride |
| SMILES | CC(C)[N+](C)(C)C(C)C.CCCCS(=O)(=O)O.[F-] |
| InChI | InChI=1S/C8H20N.C4H10O3S.FH/c1-7(2)9(5,6)8(3)4;1-2-3-4-8(5,6)7;/h7-8H,1-6H3;2-4H2,1H3,(H,5,6,7);1H/q+1;;/p-1 |
| InChIKey | MLKBOFXKJGBXHI-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride?
The IUPAC name of butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride (CID 174969617) is butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride.
What is the SMILES notation for butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride?
The canonical SMILES for butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride is CC(C)[N+](C)(C)C(C)C.CCCCS(=O)(=O)O.[F-].
What is the InChIKey of butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride?
The InChIKey is MLKBOFXKJGBXHI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C4H10O3S.FH/c1-7(2)9(5,6)8(3)4;1-2-3-4-8(5,6)7;/h7-8H,1-6H3;2-4H2,1H3,(H,5,6,7);1H/q+1;;/p-1.
What are the key properties of butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride?
butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride has a molecular weight of 287.44 g/mol, XLogP of -0.44, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1-sulfonic acid;dimethyl-di(propan-2-yl)azanium;fluoride is sourced from PubChem (CID 174969617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).