C16H12F4N2O2 — CID 174970231
N-[3-[(2,2-difluoroacetyl)amino]-2,6-difluorophenyl]-3-methylbenzamide (PubChem CID 174970231) has the molecular formula C16H12F4N2O2 and a molecular weight of 340.28 g/mol. Its IUPAC name is N-[3-[(2,2-difluoroacetyl)amino]-2,6-difluorophenyl]-3-methylbenzamide.
| Compound Name | N-[3-[(2,2-difluoroacetyl)amino]-2,6-difluorophenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 174970231 |
| Molecular Formula | C16H12F4N2O2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-[3-[(2,2-difluoroacetyl)amino]-2,6-difluorophenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2c(F)ccc(NC(=O)C(F)F)c2F)c1 |
| InChI | InChI=1S/C16H12F4N2O2/c1-8-3-2-4-9(7-8)15(23)22-13-10(17)5-6-11(12(13)18)21-16(24)14(19)20/h2-7,14H,1H3,(H,21,24)(H,22,23) |
| InChIKey | SLQZUPLYZMQDHP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |