About morpholine-2,2-diamine
morpholine-2,2-diamine (PubChem CID 174971872) has the molecular formula C4H11N3O
and a molecular weight of 117.15 g/mol. Its IUPAC name is morpholine-2,2-diamine.
Molecular Properties
| Compound Name | morpholine-2,2-diamine |
| PubChem CID | 174971872 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | morpholine-2,2-diamine |
| SMILES | NC1(N)CNCCO1 |
| InChI | InChI=1S/C4H11N3O/c5-4(6)3-7-1-2-8-4/h7H,1-3,5-6H2 |
| InChIKey | PLTGOYZUQGDZMP-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze morpholine-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine-2,2-diamine?
The IUPAC name of morpholine-2,2-diamine (CID 174971872) is morpholine-2,2-diamine.
What is the SMILES notation for morpholine-2,2-diamine?
The canonical SMILES for morpholine-2,2-diamine is NC1(N)CNCCO1.
What is the InChIKey of morpholine-2,2-diamine?
The InChIKey is PLTGOYZUQGDZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O/c5-4(6)3-7-1-2-8-4/h7H,1-3,5-6H2.
What are the key properties of morpholine-2,2-diamine?
morpholine-2,2-diamine has a molecular weight of 117.15 g/mol, XLogP of -1.82, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-2,2-diamine is sourced from PubChem (CID 174971872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).