C19H26F3NO3 — CID 174973134
tert-butyl formate;[(2R)-pyrrolidin-2-yl]-[3,4,5-tris(fluoromethyl)phenyl]methanone (PubChem CID 174973134) has the molecular formula C19H26F3NO3 and a molecular weight of 373.42 g/mol. Its IUPAC name is tert-butyl formate;[(2R)-pyrrolidin-2-yl]-[3,4,5-tris(fluoromethyl)phenyl]methanone.
| Compound Name | tert-butyl formate;[(2R)-pyrrolidin-2-yl]-[3,4,5-tris(fluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 174973134 |
| Molecular Formula | C19H26F3NO3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | tert-butyl formate;[(2R)-pyrrolidin-2-yl]-[3,4,5-tris(fluoromethyl)phenyl]methanone |
| SMILES | CC(C)(C)OC=O.O=C(c1cc(CF)c(CF)c(CF)c1)[C@H]1CCCN1 |
| InChI | InChI=1S/C14H16F3NO.C5H10O2/c15-6-10-4-9(5-11(7-16)12(10)8-17)14(19)13-2-1-3-18-13;1-5(2,3)7-4-6/h4-5,13,18H,1-3,6-8H2;4H,1-3H3/t13-;/m1./s1 |
| InChIKey | PIICLOUMXHBHGV-BTQNPOSSSA-N |
| XLogP | 3.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|