About 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid
4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid (PubChem CID 174974555) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid |
| PubChem CID | 174974555 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid |
| SMILES | O=C(O)C1(CCC2CCCCC2)CCC2OC23OC13 |
| InChI | InChI=1S/C15H22O4/c16-13(17)14(8-6-10-4-2-1-3-5-10)9-7-11-15(18-11)12(14)19-15/h10-12H,1-9H2,(H,16,17) |
| InChIKey | VYDLOWMMKIPJHD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid?
The IUPAC name of 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid (CID 174974555) is 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid.
What is the SMILES notation for 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid?
The canonical SMILES for 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid is O=C(O)C1(CCC2CCCCC2)CCC2OC23OC13.
What is the InChIKey of 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid?
The InChIKey is VYDLOWMMKIPJHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c16-13(17)14(8-6-10-4-2-1-3-5-10)9-7-11-15(18-11)12(14)19-15/h10-12H,1-9H2,(H,16,17).
What are the key properties of 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid?
4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid has a molecular weight of 266.34 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclohexylethyl)-2,8-dioxatricyclo[5.1.0.01,3]octane-4-carboxylic acid is sourced from PubChem (CID 174974555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).