C17H28O4 — CID 23344493
3-(3-cyclohexylpropyl)-3-ethylcyclobutane-1,1-dicarboxylic acid (PubChem CID 23344493) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(3-cyclohexylpropyl)-3-ethylcyclobutane-1,1-dicarboxylic acid.
| Compound Name | 3-(3-cyclohexylpropyl)-3-ethylcyclobutane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 23344493 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 3-(3-cyclohexylpropyl)-3-ethylcyclobutane-1,1-dicarboxylic acid |
| SMILES | CCC1(CCCC2CCCCC2)CC(C(=O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C17H28O4/c1-2-16(10-6-9-13-7-4-3-5-8-13)11-17(12-16,14(18)19)15(20)21/h13H,2-12H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | NDNLRSOWQUZFFO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|