C19H20BrN3O5S — CID 17497520
4-bromo-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-3,5-dimethoxybenzamide (PubChem CID 17497520) has the molecular formula C19H20BrN3O5S and a molecular weight of 482.36 g/mol. Its IUPAC name is 4-bromo-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 17497520 |
| Molecular Formula | C19H20BrN3O5S |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 4-bromo-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cccc(S(=O)(=O)NC3=NCCC3)c2)cc(OC)c1Br |
| InChI | InChI=1S/C19H20BrN3O5S/c1-27-15-9-12(10-16(28-2)18(15)20)19(24)22-13-5-3-6-14(11-13)29(25,26)23-17-7-4-8-21-17/h3,5-6,9-11H,4,7-8H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | IPSLJGPTNWKLRS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |