C18H18ClN3O4S — CID 26901878
5-chloro-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-methoxybenzamide (PubChem CID 26901878) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is 5-chloro-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 26901878 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 5-chloro-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1cccc(S(=O)(=O)NC2=NCCC2)c1 |
| InChI | InChI=1S/C18H18ClN3O4S/c1-26-16-8-7-12(19)10-15(16)18(23)21-13-4-2-5-14(11-13)27(24,25)22-17-6-3-9-20-17/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ZZSREBKLGFRNLF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |