C18H19N3O4S — CID 9117099
N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-methoxybenzamide (PubChem CID 9117099) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-methoxybenzamide.
| Compound Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 9117099 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1cccc(S(=O)(=O)NC2=NCCC2)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-25-16-9-3-2-8-15(16)18(22)20-13-6-4-7-14(12-13)26(23,24)21-17-10-5-11-19-17/h2-4,6-9,12H,5,10-11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | MEBSVJZPDIYRAR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |