C26H22N4O3S — CID 3883463
N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide (PubChem CID 3883463) has the molecular formula C26H22N4O3S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3883463 |
| Molecular Formula | C26H22N4O3S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2=NCCC2)c1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C26H22N4O3S/c31-26(28-19-10-6-11-20(16-19)34(32,33)30-25-14-7-15-27-25)22-17-24(18-8-2-1-3-9-18)29-23-13-5-4-12-21(22)23/h1-6,8-13,16-17H,7,14-15H2,(H,27,30)(H,28,31) |
| InChIKey | HJCXCLPUWVXAGE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |