C22H22N4O3S — CID 60583682
N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-prop-2-enylindole-3-carboxamide (PubChem CID 60583682) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-prop-2-enylindole-3-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-prop-2-enylindole-3-carboxamide |
|---|---|
| PubChem CID | 60583682 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-prop-2-enylindole-3-carboxamide |
| SMILES | C=CCn1cc(C(=O)Nc2cccc(S(=O)(=O)NC3=NCCC3)c2)c2ccccc21 |
| InChI | InChI=1S/C22H22N4O3S/c1-2-13-26-15-19(18-9-3-4-10-20(18)26)22(27)24-16-7-5-8-17(14-16)30(28,29)25-21-11-6-12-23-21/h2-5,7-10,14-15H,1,6,11-13H2,(H,23,25)(H,24,27) |
| InChIKey | STRKCSYXTOEUBQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|