C17H13F4N3O3S — CID 25162510
N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 25162510) has the molecular formula C17H13F4N3O3S and a molecular weight of 415.37 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 25162510 |
| Molecular Formula | C17H13F4N3O3S |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2=NCCC2)c1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H13F4N3O3S/c18-12-8-11(14(19)16(21)15(12)20)17(25)23-9-3-1-4-10(7-9)28(26,27)24-13-5-2-6-22-13/h1,3-4,7-8H,2,5-6H2,(H,22,24)(H,23,25) |
| InChIKey | YIMMOFRIVGFPGV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|