About 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol
4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol (PubChem CID 174975485) has the molecular formula C8H9ClN4O2S
and a molecular weight of 260.71 g/mol. Its IUPAC name is 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol.
Molecular Properties
| Compound Name | 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol |
| PubChem CID | 174975485 |
| Molecular Formula | C8H9ClN4O2S |
| Molecular Weight | 260.71 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol |
| SMILES | Cc1nnsc1C(=O)Cl.OCc1ccn[nH]1 |
| InChI | InChI=1S/C4H3ClN2OS.C4H6N2O/c1-2-3(4(5)8)9-7-6-2;7-3-4-1-2-5-6-4/h1H3;1-2,7H,3H2,(H,5,6) |
| InChIKey | JWYQWSDZIDRICD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.71 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol?
The IUPAC name of 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol (CID 174975485) is 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol.
What is the SMILES notation for 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol?
The canonical SMILES for 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol is Cc1nnsc1C(=O)Cl.OCc1ccn[nH]1.
What is the InChIKey of 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol?
The InChIKey is JWYQWSDZIDRICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClN2OS.C4H6N2O/c1-2-3(4(5)8)9-7-6-2;7-3-4-1-2-5-6-4/h1H3;1-2,7H,3H2,(H,5,6).
What are the key properties of 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol?
4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol has a molecular weight of 260.71 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylthiadiazole-5-carbonyl chloride;1H-pyrazol-5-ylmethanol is sourced from PubChem (CID 174975485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).