C32H27N5O3 — CID 174982586
3-morpholin-4-yl-1-trityl-2H-imidazo[4,5-f]indazole-6-carboxylic acid (PubChem CID 174982586) has the molecular formula C32H27N5O3 and a molecular weight of 529.60 g/mol. Its IUPAC name is 3-morpholin-4-yl-1-trityl-2H-imidazo[4,5-f]indazole-6-carboxylic acid.
| Compound Name | 3-morpholin-4-yl-1-trityl-2H-imidazo[4,5-f]indazole-6-carboxylic acid |
|---|---|
| PubChem CID | 174982586 |
| Molecular Formula | C32H27N5O3 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 3-morpholin-4-yl-1-trityl-2H-imidazo[4,5-f]indazole-6-carboxylic acid |
| SMILES | O=C(O)c1nc2cc3c(N4CCOCC4)[nH]n(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2n1 |
| InChI | InChI=1S/C32H27N5O3/c38-31(39)29-33-26-20-25-28(21-27(26)34-29)37(35-30(25)36-16-18-40-19-17-36)32(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,20-21,35H,16-19H2,(H,38,39) |
| InChIKey | YOUHFPLLMIECHI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|