About 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one
3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one (PubChem CID 136984237) has the molecular formula C33H28N4O2
and a molecular weight of 512.61 g/mol. Its IUPAC name is 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one.
Molecular Properties
| Compound Name | 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one |
| PubChem CID | 136984237 |
| Molecular Formula | C33H28N4O2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one |
| SMILES | O=c1ccc2cc3c(N4CCOCC4)nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2[nH]1 |
| InChI | InChI=1S/C33H28N4O2/c38-31-17-16-24-22-28-30(23-29(24)34-31)37(35-32(28)36-18-20-39-21-19-36)33(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-17,22-23H,18-21H2,(H,34,38) |
| InChIKey | BWDLDYAOSKSVPN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one?
The IUPAC name of 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one (CID 136984237) is 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one.
What is the SMILES notation for 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one?
The canonical SMILES for 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one is O=c1ccc2cc3c(N4CCOCC4)nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2[nH]1.
What is the InChIKey of 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one?
The InChIKey is BWDLDYAOSKSVPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H28N4O2/c38-31-17-16-24-22-28-30(23-29(24)34-31)37(35-32(28)36-18-20-39-21-19-36)33(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-17,22-23H,18-21H2,(H,34,38).
What are the key properties of 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one?
3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one has a molecular weight of 512.61 g/mol, XLogP of 5.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-yl-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one is sourced from PubChem (CID 136984237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).