C16H16NOP — CID 174982709
[3-(4,5-dihydro-1,2-oxazol-3-yl)phenyl]-methyl-phenylphosphane (PubChem CID 174982709) has the molecular formula C16H16NOP and a molecular weight of 269.28 g/mol. Its IUPAC name is [3-(4,5-dihydro-1,2-oxazol-3-yl)phenyl]-methyl-phenylphosphane.
| Compound Name | [3-(4,5-dihydro-1,2-oxazol-3-yl)phenyl]-methyl-phenylphosphane |
|---|---|
| PubChem CID | 174982709 |
| Molecular Formula | C16H16NOP |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [3-(4,5-dihydro-1,2-oxazol-3-yl)phenyl]-methyl-phenylphosphane |
| SMILES | CP(c1ccccc1)c1cccc(C2=NOCC2)c1 |
| InChI | InChI=1S/C16H16NOP/c1-19(14-7-3-2-4-8-14)15-9-5-6-13(12-15)16-10-11-18-17-16/h2-9,12H,10-11H2,1H3 |
| InChIKey | RBGCHOGGLFSGPV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|