About 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate
1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate (PubChem CID 174984016) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate.
Molecular Properties
| Compound Name | 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate |
| PubChem CID | 174984016 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate |
| SMILES | COC(=O)/C(C)=C(/CCC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C14H24O4/c1-9(2)7-8-12(11(5)13(15)17-6)14(16)18-10(3)4/h9-10H,7-8H2,1-6H3/b12-11- |
| InChIKey | LZGFNLBCRXYGON-QXMHVHEDSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate?
The IUPAC name of 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate (CID 174984016) is 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate.
What is the SMILES notation for 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate?
The canonical SMILES for 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate is COC(=O)/C(C)=C(/CCC(C)C)C(=O)OC(C)C.
What is the InChIKey of 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate?
The InChIKey is LZGFNLBCRXYGON-QXMHVHEDSA-N. The full InChI is InChI=1S/C14H24O4/c1-9(2)7-8-12(11(5)13(15)17-6)14(16)18-10(3)4/h9-10H,7-8H2,1-6H3/b12-11-.
What are the key properties of 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate?
1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate has a molecular weight of 256.34 g/mol, XLogP of 2.86, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 4-O-propan-2-yl (Z)-2-methyl-3-(3-methylbutyl)but-2-enedioate is sourced from PubChem (CID 174984016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).