About 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile
7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile (PubChem CID 174987155) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile.
Analyze 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile?
The IUPAC name of 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile (CID 174987155) is 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile.
What is the SMILES notation for 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile?
The canonical SMILES for 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile is CCC#N.c1cc2ccc1o2.
What is the InChIKey of 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile?
The InChIKey is CAQVSKYBTLQNCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O.C3H5N/c1-2-6-4-3-5(1)7-6;1-2-3-4/h1-4H;2H2,1H3.
What are the key properties of 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile?
7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile has a molecular weight of 147.18 g/mol, XLogP of 2.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;propanenitrile is sourced from PubChem (CID 174987155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).