C20H15N5O2 — CID 174990742
(E)-2-cyano-3-cyclopropyl-N-formyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]prop-2-enamide (PubChem CID 174990742) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is (E)-2-cyano-3-cyclopropyl-N-formyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-cyclopropyl-N-formyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 174990742 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (E)-2-cyano-3-cyclopropyl-N-formyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]prop-2-enamide |
| SMILES | N#C/C(C(=O)NC=O)=C(\c1ccc(-c2ncnc3[nH]ccc23)cc1)C1CC1 |
| InChI | InChI=1S/C20H15N5O2/c21-9-16(20(27)25-11-26)17(12-1-2-12)13-3-5-14(6-4-13)18-15-7-8-22-19(15)24-10-23-18/h3-8,10-12H,1-2H2,(H,22,23,24)(H,25,26,27)/b17-16+ |
| InChIKey | VHZPOJRCMRSGRN-WUKNDPDISA-N |
| XLogP | 2.58 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|