C20H39NO2 — CID 174992167
(Z)-2-hydroxy-N,N-dimethyloctadec-9-enamide (PubChem CID 174992167) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is (Z)-2-hydroxy-N,N-dimethyloctadec-9-enamide.
| Compound Name | (Z)-2-hydroxy-N,N-dimethyloctadec-9-enamide |
|---|---|
| PubChem CID | 174992167 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | (Z)-2-hydroxy-N,N-dimethyloctadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCC(O)C(=O)N(C)C |
| InChI | InChI=1S/C20H39NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(22)20(23)21(2)3/h11-12,19,22H,4-10,13-18H2,1-3H3/b12-11- |
| InChIKey | HKCHNKRBWVANMK-QXMHVHEDSA-N |
| XLogP | 5.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|