About (1-amino-6-methylheptyl) pentanoate
(1-amino-6-methylheptyl) pentanoate (PubChem CID 174993094) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is (1-amino-6-methylheptyl) pentanoate.
Molecular Properties
| Compound Name | (1-amino-6-methylheptyl) pentanoate |
| PubChem CID | 174993094 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | (1-amino-6-methylheptyl) pentanoate |
| SMILES | CCCCC(=O)OC(N)CCCCC(C)C |
| InChI | InChI=1S/C13H27NO2/c1-4-5-10-13(15)16-12(14)9-7-6-8-11(2)3/h11-12H,4-10,14H2,1-3H3 |
| InChIKey | LSFLPMUQRUJQTN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-6-methylheptyl) pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-6-methylheptyl) pentanoate?
The IUPAC name of (1-amino-6-methylheptyl) pentanoate (CID 174993094) is (1-amino-6-methylheptyl) pentanoate.
What is the SMILES notation for (1-amino-6-methylheptyl) pentanoate?
The canonical SMILES for (1-amino-6-methylheptyl) pentanoate is CCCCC(=O)OC(N)CCCCC(C)C.
What is the InChIKey of (1-amino-6-methylheptyl) pentanoate?
The InChIKey is LSFLPMUQRUJQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-4-5-10-13(15)16-12(14)9-7-6-8-11(2)3/h11-12H,4-10,14H2,1-3H3.
What are the key properties of (1-amino-6-methylheptyl) pentanoate?
(1-amino-6-methylheptyl) pentanoate has a molecular weight of 229.36 g/mol, XLogP of 3.22, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-6-methylheptyl) pentanoate is sourced from PubChem (CID 174993094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).