About carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate
carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate (PubChem CID 174993698) has the molecular formula C12H20O7
and a molecular weight of 276.28 g/mol. Its IUPAC name is carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate.
Molecular Properties
| Compound Name | carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate |
| PubChem CID | 174993698 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate |
| SMILES | CCCCC(C)(CCCC=O)OC(=O)OOC(=O)O |
| InChI | InChI=1S/C12H20O7/c1-3-4-7-12(2,8-5-6-9-13)17-11(16)19-18-10(14)15/h9H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | QAYOECGBBFWREZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate?
The IUPAC name of carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate (CID 174993698) is carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate.
What is the SMILES notation for carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate?
The canonical SMILES for carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate is CCCCC(C)(CCCC=O)OC(=O)OOC(=O)O.
What is the InChIKey of carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate?
The InChIKey is QAYOECGBBFWREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O7/c1-3-4-7-12(2,8-5-6-9-13)17-11(16)19-18-10(14)15/h9H,3-8H2,1-2H3,(H,14,15).
What are the key properties of carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate?
carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate has a molecular weight of 276.28 g/mol, XLogP of 3.07, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carboxyoxy (5-methyl-1-oxononan-5-yl) carbonate is sourced from PubChem (CID 174993698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).