About carboxyoxy dodecyl carbonate
carboxyoxy dodecyl carbonate (PubChem CID 89262401) has the molecular formula C14H26O6
and a molecular weight of 290.36 g/mol. Its IUPAC name is carboxyoxy dodecyl carbonate.
Molecular Properties
| Compound Name | carboxyoxy dodecyl carbonate |
| PubChem CID | 89262401 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | carboxyoxy dodecyl carbonate |
| SMILES | CCCCCCCCCCCCOC(=O)OOC(=O)O |
| InChI | InChI=1S/C14H26O6/c1-2-3-4-5-6-7-8-9-10-11-12-18-14(17)20-19-13(15)16/h2-12H2,1H3,(H,15,16) |
| InChIKey | SYYUTBXIBOGMAW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carboxyoxy dodecyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxyoxy dodecyl carbonate?
The IUPAC name of carboxyoxy dodecyl carbonate (CID 89262401) is carboxyoxy dodecyl carbonate.
What is the SMILES notation for carboxyoxy dodecyl carbonate?
The canonical SMILES for carboxyoxy dodecyl carbonate is CCCCCCCCCCCCOC(=O)OOC(=O)O.
What is the InChIKey of carboxyoxy dodecyl carbonate?
The InChIKey is SYYUTBXIBOGMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O6/c1-2-3-4-5-6-7-8-9-10-11-12-18-14(17)20-19-13(15)16/h2-12H2,1H3,(H,15,16).
What are the key properties of carboxyoxy dodecyl carbonate?
carboxyoxy dodecyl carbonate has a molecular weight of 290.36 g/mol, XLogP of 4.67, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carboxyoxy dodecyl carbonate is sourced from PubChem (CID 89262401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).