C20H16N2O5 — CID 174994221
4-oxo-4-[[2-oxo-1-(2-oxoindol-5-yl)-2-phenylethyl]amino]butanoic acid (PubChem CID 174994221) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 4-oxo-4-[[2-oxo-1-(2-oxoindol-5-yl)-2-phenylethyl]amino]butanoic acid.
| Compound Name | 4-oxo-4-[[2-oxo-1-(2-oxoindol-5-yl)-2-phenylethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 174994221 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-oxo-4-[[2-oxo-1-(2-oxoindol-5-yl)-2-phenylethyl]amino]butanoic acid |
| SMILES | O=C(O)CCC(=O)NC(C(=O)c1ccccc1)c1ccc2c(c1)=CC(=O)N=2 |
| InChI | InChI=1S/C20H16N2O5/c23-16(8-9-18(25)26)22-19(20(27)12-4-2-1-3-5-12)13-6-7-15-14(10-13)11-17(24)21-15/h1-7,10-11,19H,8-9H2,(H,22,23)(H,25,26) |
| InChIKey | AVWPDGPAFJHXLY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |