C67H64N6O9 — CID 174994900
bis[1-[2-nitro-4-(4-tritylpiperazine-1-carbonyl)phenyl]propan-2-yl] carbonate (PubChem CID 174994900) has the molecular formula C67H64N6O9 and a molecular weight of 1097.28 g/mol. Its IUPAC name is bis[1-[2-nitro-4-(4-tritylpiperazine-1-carbonyl)phenyl]propan-2-yl] carbonate.
| Compound Name | bis[1-[2-nitro-4-(4-tritylpiperazine-1-carbonyl)phenyl]propan-2-yl] carbonate |
|---|---|
| PubChem CID | 174994900 |
| Molecular Formula | C67H64N6O9 |
| Molecular Weight | 1097.28 g/mol |
| Exact Mass | 1096.47 |
| IUPAC Name | bis[1-[2-nitro-4-(4-tritylpiperazine-1-carbonyl)phenyl]propan-2-yl] carbonate |
| SMILES | CC(Cc1ccc(C(=O)N2CCN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC2)cc1[N+](=O)[O-])OC(=O)OC(C)Cc1ccc(C(=O)N2CCN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C67H64N6O9/c1-49(45-51-33-35-53(47-61(51)72(77)78)63(74)68-37-41-70(42-38-68)66(55-21-9-3-10-22-55,56-23-11-4-12-24-56)57-25-13-5-14-26-57)81-65(76)82-50(2)46-52-34-36-54(48-62(52)73(79)80)64(75)69-39-43-71(44-40-69)67(58-27-15-6-16-28-58,59-29-17-7-18-30-59)60-31-19-8-20-32-60/h3-36,47-50H,37-46H2,1-2H3 |
| InChIKey | GMZBHPYCXSFIPN-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 168.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.28 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|