About diethylphosphoryl triethyl silicate
diethylphosphoryl triethyl silicate (PubChem CID 174995668) has the molecular formula C10H25O5PSi
and a molecular weight of 284.36 g/mol. Its IUPAC name is diethylphosphoryl triethyl silicate.
Molecular Properties
| Compound Name | diethylphosphoryl triethyl silicate |
| PubChem CID | 174995668 |
| Molecular Formula | C10H25O5PSi |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | diethylphosphoryl triethyl silicate |
| SMILES | CCO[Si](OCC)(OCC)OP(=O)(CC)CC |
| InChI | InChI=1S/C10H25O5PSi/c1-6-12-17(13-7-2,14-8-3)15-16(11,9-4)10-5/h6-10H2,1-5H3 |
| InChIKey | KVLPFZJEMXIQES-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethylphosphoryl triethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylphosphoryl triethyl silicate?
The IUPAC name of diethylphosphoryl triethyl silicate (CID 174995668) is diethylphosphoryl triethyl silicate.
What is the SMILES notation for diethylphosphoryl triethyl silicate?
The canonical SMILES for diethylphosphoryl triethyl silicate is CCO[Si](OCC)(OCC)OP(=O)(CC)CC.
What is the InChIKey of diethylphosphoryl triethyl silicate?
The InChIKey is KVLPFZJEMXIQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25O5PSi/c1-6-12-17(13-7-2,14-8-3)15-16(11,9-4)10-5/h6-10H2,1-5H3.
What are the key properties of diethylphosphoryl triethyl silicate?
diethylphosphoryl triethyl silicate has a molecular weight of 284.36 g/mol, XLogP of 2.87, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethylphosphoryl triethyl silicate is sourced from PubChem (CID 174995668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).