C7H14N2O6S2 — CID 174995939
4-(prop-2-enoylamino)butylsulfonylsulfamic acid (PubChem CID 174995939) has the molecular formula C7H14N2O6S2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-(prop-2-enoylamino)butylsulfonylsulfamic acid.
| Compound Name | 4-(prop-2-enoylamino)butylsulfonylsulfamic acid |
|---|---|
| PubChem CID | 174995939 |
| Molecular Formula | C7H14N2O6S2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4-(prop-2-enoylamino)butylsulfonylsulfamic acid |
| SMILES | C=CC(=O)NCCCCS(=O)(=O)NS(=O)(=O)O |
| InChI | InChI=1S/C7H14N2O6S2/c1-2-7(10)8-5-3-4-6-16(11,12)9-17(13,14)15/h2,9H,1,3-6H2,(H,8,10)(H,13,14,15) |
| InChIKey | SKKRCRCPDJWZCS-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|