C32H72NO9P — CID 174996961
2-[dodecyl(2-hydroxyethoxy)amino]oxyethanol;3-(2-ethylhexoxymethyl)heptane;phosphoric acid (PubChem CID 174996961) has the molecular formula C32H72NO9P and a molecular weight of 645.90 g/mol. Its IUPAC name is 2-[dodecyl(2-hydroxyethoxy)amino]oxyethanol;3-(2-ethylhexoxymethyl)heptane;phosphoric acid.
| Compound Name | 2-[dodecyl(2-hydroxyethoxy)amino]oxyethanol;3-(2-ethylhexoxymethyl)heptane;phosphoric acid |
|---|---|
| PubChem CID | 174996961 |
| Molecular Formula | C32H72NO9P |
| Molecular Weight | 645.90 g/mol |
| Exact Mass | 645.49 |
| IUPAC Name | 2-[dodecyl(2-hydroxyethoxy)amino]oxyethanol;3-(2-ethylhexoxymethyl)heptane;phosphoric acid |
| SMILES | CCCCC(CC)COCC(CC)CCCC.CCCCCCCCCCCCN(OCCO)OCCO.O=P(O)(O)O |
| InChI | InChI=1S/C16H35NO4.C16H34O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-17(20-15-13-18)21-16-14-19;1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2;1-5(2,3)4/h18-19H,2-16H2,1H3;15-16H,5-14H2,1-4H3;(H3,1,2,3,4) |
| InChIKey | WEQDXNXGXBOFCW-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.90 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|