C37H77NO6 — CID 90146048
2-[2-hydroxyethoxy(pentadecyl)amino]oxyethanol;octadecanoic acid (PubChem CID 90146048) has the molecular formula C37H77NO6 and a molecular weight of 632.02 g/mol. Its IUPAC name is 2-[2-hydroxyethoxy(pentadecyl)amino]oxyethanol;octadecanoic acid.
| Compound Name | 2-[2-hydroxyethoxy(pentadecyl)amino]oxyethanol;octadecanoic acid |
|---|---|
| PubChem CID | 90146048 |
| Molecular Formula | C37H77NO6 |
| Molecular Weight | 632.02 g/mol |
| Exact Mass | 631.58 |
| IUPAC Name | 2-[2-hydroxyethoxy(pentadecyl)amino]oxyethanol;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCCN(OCCO)OCCO |
| InChI | InChI=1S/C19H41NO4.C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(23-18-16-21)24-19-17-22;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h21-22H,2-19H2,1H3;2-17H2,1H3,(H,19,20) |
| InChIKey | CZMGAKHZVJQYCD-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.02 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|