C12H25NO10 — CID 173031633
2-[butyl(2-hydroxyethoxy)amino]oxyethanol;2,3-dihydroxybutanedioic acid (PubChem CID 173031633) has the molecular formula C12H25NO10 and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-[butyl(2-hydroxyethoxy)amino]oxyethanol;2,3-dihydroxybutanedioic acid.
| Compound Name | 2-[butyl(2-hydroxyethoxy)amino]oxyethanol;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 173031633 |
| Molecular Formula | C12H25NO10 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[butyl(2-hydroxyethoxy)amino]oxyethanol;2,3-dihydroxybutanedioic acid |
| SMILES | CCCCN(OCCO)OCCO.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C8H19NO4.C4H6O6/c1-2-3-4-9(12-7-5-10)13-8-6-11;5-1(3(7)8)2(6)4(9)10/h10-11H,2-8H2,1H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | SATKRUGVVHYVTC-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 177.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|