C46H99N3O18 — CID 173155044
tris(2-[butyl(2-hydroxyethoxy)amino]oxyethanol);undecanedioic acid;undecanoic acid (PubChem CID 173155044) has the molecular formula C46H99N3O18 and a molecular weight of 982.30 g/mol. Its IUPAC name is tris(2-[butyl(2-hydroxyethoxy)amino]oxyethanol);undecanedioic acid;undecanoic acid.
| Compound Name | tris(2-[butyl(2-hydroxyethoxy)amino]oxyethanol);undecanedioic acid;undecanoic acid |
|---|---|
| PubChem CID | 173155044 |
| Molecular Formula | C46H99N3O18 |
| Molecular Weight | 982.30 g/mol |
| Exact Mass | 981.69 |
| IUPAC Name | tris(2-[butyl(2-hydroxyethoxy)amino]oxyethanol);undecanedioic acid;undecanoic acid |
| SMILES | CCCCCCCCCCC(=O)O.CCCCN(OCCO)OCCO.CCCCN(OCCO)OCCO.CCCCN(OCCO)OCCO.O=C(O)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C11H20O4.C11H22O2.3C8H19NO4/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15;1-2-3-4-5-6-7-8-9-10-11(12)13;3*1-2-3-4-9(12-7-5-10)13-8-6-11/h1-9H2,(H,12,13)(H,14,15);2-10H2,1H3,(H,12,13);3*10-11H,2-8H2,1H3 |
| InChIKey | SGLZFCJFBVMLLJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 298.38 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 67 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.30 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|