About 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid
2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid (PubChem CID 87879074) has the molecular formula C26H56N2O11
and a molecular weight of 572.74 g/mol. Its IUPAC name is 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid.
Molecular Properties
| Compound Name | 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid |
| PubChem CID | 87879074 |
| Molecular Formula | C26H56N2O11 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.OCCON(OCCO)ON(OCCO)OCCO |
| InChI | InChI=1S/C18H36O2.C8H20N2O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;11-1-5-15-9(16-6-2-12)19-10(17-7-3-13)18-8-4-14/h2-17H2,1H3,(H,19,20);11-14H,1-8H2 |
| InChIKey | RMHNVXHPYBNGQM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid?
The IUPAC name of 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid (CID 87879074) is 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid.
What is the SMILES notation for 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid?
The canonical SMILES for 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.OCCON(OCCO)ON(OCCO)OCCO.
What is the InChIKey of 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid?
The InChIKey is RMHNVXHPYBNGQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C8H20N2O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;11-1-5-15-9(16-6-2-12)19-10(17-7-3-13)18-8-4-14/h2-17H2,1H3,(H,19,20);11-14H,1-8H2.
What are the key properties of 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid?
2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid has a molecular weight of 572.74 g/mol, XLogP of 3.47, 30 rotatable bonds, 5 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[bis(2-hydroxyethoxy)amino]oxy-(2-hydroxyethoxy)amino]oxyethanol;octadecanoic acid is sourced from PubChem (CID 87879074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).