C18H39NO6 — CID 173031616
2-[butyl(2-hydroxyethoxy)amino]oxyethanol;decanoic acid (PubChem CID 173031616) has the molecular formula C18H39NO6 and a molecular weight of 365.51 g/mol. Its IUPAC name is 2-[butyl(2-hydroxyethoxy)amino]oxyethanol;decanoic acid.
| Compound Name | 2-[butyl(2-hydroxyethoxy)amino]oxyethanol;decanoic acid |
|---|---|
| PubChem CID | 173031616 |
| Molecular Formula | C18H39NO6 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | 2-[butyl(2-hydroxyethoxy)amino]oxyethanol;decanoic acid |
| SMILES | CCCCCCCCCC(=O)O.CCCCN(OCCO)OCCO |
| InChI | InChI=1S/C10H20O2.C8H19NO4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-9(12-7-5-10)13-8-6-11/h2-9H2,1H3,(H,11,12);10-11H,2-8H2,1H3 |
| InChIKey | SZLYLEZNBDQZLM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|