C26H58NO8P — CID 174994813
2-[dodecyl(2-hydroxyethoxy)amino]oxyethanol;2-propylheptyl dihydrogen phosphate (PubChem CID 174994813) has the molecular formula C26H58NO8P and a molecular weight of 543.72 g/mol. Its IUPAC name is 2-[dodecyl(2-hydroxyethoxy)amino]oxyethanol;2-propylheptyl dihydrogen phosphate.
| Compound Name | 2-[dodecyl(2-hydroxyethoxy)amino]oxyethanol;2-propylheptyl dihydrogen phosphate |
|---|---|
| PubChem CID | 174994813 |
| Molecular Formula | C26H58NO8P |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.39 |
| IUPAC Name | 2-[dodecyl(2-hydroxyethoxy)amino]oxyethanol;2-propylheptyl dihydrogen phosphate |
| SMILES | CCCCCC(CCC)COP(=O)(O)O.CCCCCCCCCCCCN(OCCO)OCCO |
| InChI | InChI=1S/C16H35NO4.C10H23O4P/c1-2-3-4-5-6-7-8-9-10-11-12-17(20-15-13-18)21-16-14-19;1-3-5-6-8-10(7-4-2)9-14-15(11,12)13/h18-19H,2-16H2,1H3;10H,3-9H2,1-2H3,(H2,11,12,13) |
| InChIKey | XLHLHTZXHNZVSU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|