C26H48O9 — CID 174999868
butane-1,1-diol;furan-2,5-dicarboxylic acid;hexadecane-1,3-diol (PubChem CID 174999868) has the molecular formula C26H48O9 and a molecular weight of 504.66 g/mol. Its IUPAC name is butane-1,1-diol;furan-2,5-dicarboxylic acid;hexadecane-1,3-diol.
| Compound Name | butane-1,1-diol;furan-2,5-dicarboxylic acid;hexadecane-1,3-diol |
|---|---|
| PubChem CID | 174999868 |
| Molecular Formula | C26H48O9 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | butane-1,1-diol;furan-2,5-dicarboxylic acid;hexadecane-1,3-diol |
| SMILES | CCCC(O)O.CCCCCCCCCCCCCC(O)CCO.O=C(O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C16H34O2.C6H4O5.C4H10O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(18)14-15-17;7-5(8)3-1-2-4(11-3)6(9)10;1-2-3-4(5)6/h16-18H,2-15H2,1H3;1-2H,(H,7,8)(H,9,10);4-6H,2-3H2,1H3 |
| InChIKey | BDRVBFKQVACJPI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 168.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|