C24H50O2 — CID 175001131
2,2,7,7-tetramethyl-4-(2,2,7,7-tetramethyloctan-4-ylperoxy)octane (PubChem CID 175001131) has the molecular formula C24H50O2 and a molecular weight of 370.66 g/mol. Its IUPAC name is 2,2,7,7-tetramethyl-4-(2,2,7,7-tetramethyloctan-4-ylperoxy)octane.
| Compound Name | 2,2,7,7-tetramethyl-4-(2,2,7,7-tetramethyloctan-4-ylperoxy)octane |
|---|---|
| PubChem CID | 175001131 |
| Molecular Formula | C24H50O2 |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 370.38 |
| IUPAC Name | 2,2,7,7-tetramethyl-4-(2,2,7,7-tetramethyloctan-4-ylperoxy)octane |
| SMILES | CC(C)(C)CCC(CC(C)(C)C)OOC(CCC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C24H50O2/c1-21(2,3)15-13-19(17-23(7,8)9)25-26-20(18-24(10,11)12)14-16-22(4,5)6/h19-20H,13-18H2,1-12H3 |
| InChIKey | FFUCNMFCHWGFQC-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|