C24H25N3O6 — CID 175002062
3-[(1,6-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-[3-(3-methoxyphenyl)phenyl]propanoic acid (PubChem CID 175002062) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 3-[(1,6-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-[3-(3-methoxyphenyl)phenyl]propanoic acid.
| Compound Name | 3-[(1,6-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-[3-(3-methoxyphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 175002062 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-[(1,6-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-[3-(3-methoxyphenyl)phenyl]propanoic acid |
| SMILES | COc1cccc(-c2cccc(C(CC(=O)O)NC(=O)NC3C(=O)C=C(C)N(C)C3=O)c2)c1 |
| InChI | InChI=1S/C24H25N3O6/c1-14-10-20(28)22(23(31)27(14)2)26-24(32)25-19(13-21(29)30)17-8-4-6-15(11-17)16-7-5-9-18(12-16)33-3/h4-12,19,22H,13H2,1-3H3,(H,29,30)(H2,25,26,32) |
| InChIKey | NHQLGODVKJZRJI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|