C23H22FN3O5 — CID 175002162
3-[(1,6-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-(2-fluoro-3-phenylphenyl)propanoic acid (PubChem CID 175002162) has the molecular formula C23H22FN3O5 and a molecular weight of 439.44 g/mol. Its IUPAC name is 3-[(1,6-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-(2-fluoro-3-phenylphenyl)propanoic acid.
| Compound Name | 3-[(1,6-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-(2-fluoro-3-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 175002162 |
| Molecular Formula | C23H22FN3O5 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 3-[(1,6-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-(2-fluoro-3-phenylphenyl)propanoic acid |
| SMILES | CC1=CC(=O)C(NC(=O)NC(CC(=O)O)c2cccc(-c3ccccc3)c2F)C(=O)N1C |
| InChI | InChI=1S/C23H22FN3O5/c1-13-11-18(28)21(22(31)27(13)2)26-23(32)25-17(12-19(29)30)16-10-6-9-15(20(16)24)14-7-4-3-5-8-14/h3-11,17,21H,12H2,1-2H3,(H,29,30)(H2,25,26,32) |
| InChIKey | WHLNNQWYZJMSAV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|