C23H21FN3NaO5 — CID 175930028
sodium (3S)-3-[(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-(2-fluoro-5-phenylphenyl)propanoate (PubChem CID 175930028) has the molecular formula C23H21FN3NaO5 and a molecular weight of 461.43 g/mol. Its IUPAC name is sodium (3S)-3-[(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-(2-fluoro-5-phenylphenyl)propanoate.
| Compound Name | sodium (3S)-3-[(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-(2-fluoro-5-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 175930028 |
| Molecular Formula | C23H21FN3NaO5 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | sodium (3S)-3-[(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-(2-fluoro-5-phenylphenyl)propanoate |
| SMILES | CC1=CN(C)C(=O)C(NC(=O)N[C@@H](CC(=O)[O-])c2cc(-c3ccccc3)ccc2F)C1=O.[Na+] |
| InChI | InChI=1S/C23H22FN3O5.Na/c1-13-12-27(2)22(31)20(21(13)30)26-23(32)25-18(11-19(28)29)16-10-15(8-9-17(16)24)14-6-4-3-5-7-14;/h3-10,12,18,20H,11H2,1-2H3,(H,28,29)(H2,25,26,32);/q;+1/p-1/t18-,20?;/m0./s1 |
| InChIKey | ZRFIYOXLOHRLTJ-ISZYABMKSA-M |
| XLogP | -1.71 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|