C24H24FN3O5 — CID 175929991
(3S)-3-[5-(2,6-dimethylphenyl)-2-fluorophenyl]-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid (PubChem CID 175929991) has the molecular formula C24H24FN3O5 and a molecular weight of 453.47 g/mol. Its IUPAC name is (3S)-3-[5-(2,6-dimethylphenyl)-2-fluorophenyl]-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid.
| Compound Name | (3S)-3-[5-(2,6-dimethylphenyl)-2-fluorophenyl]-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 175929991 |
| Molecular Formula | C24H24FN3O5 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (3S)-3-[5-(2,6-dimethylphenyl)-2-fluorophenyl]-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
| SMILES | Cc1cccc(C)c1-c1ccc(F)c([C@H](CC(=O)O)NC(=O)NC2C(=O)C=CN(C)C2=O)c1 |
| InChI | InChI=1S/C24H24FN3O5/c1-13-5-4-6-14(2)21(13)15-7-8-17(25)16(11-15)18(12-20(30)31)26-24(33)27-22-19(29)9-10-28(3)23(22)32/h4-11,18,22H,12H2,1-3H3,(H,30,31)(H2,26,27,33)/t18-,22?/m0/s1 |
| InChIKey | LSKZTUKEJWUXMM-HXBUSHRASA-N |
| XLogP | 2.85 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|