C24H26N3NaO5 — CID 175025988
sodium;hydride;(3S)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-[4-[(4-methylphenyl)methyl]phenyl]propanoic acid (PubChem CID 175025988) has the molecular formula C24H26N3NaO5 and a molecular weight of 459.48 g/mol. Its IUPAC name is sodium;hydride;(3S)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-[4-[(4-methylphenyl)methyl]phenyl]propanoic acid.
| Compound Name | sodium;hydride;(3S)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-[4-[(4-methylphenyl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 175025988 |
| Molecular Formula | C24H26N3NaO5 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | sodium;hydride;(3S)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]-3-[4-[(4-methylphenyl)methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(Cc2ccc([C@H](CC(=O)O)NC(=O)NC3C(=O)C=CN(C)C3=O)cc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C24H25N3O5.Na.H/c1-15-3-5-16(6-4-15)13-17-7-9-18(10-8-17)19(14-21(29)30)25-24(32)26-22-20(28)11-12-27(2)23(22)31;;/h3-12,19,22H,13-14H2,1-2H3,(H,29,30)(H2,25,26,32);;/q;+1;-1/t19-,22?;;/m0../s1 |
| InChIKey | XHBLBOAPNVYEOZ-NCNDTFMYSA-N |
| XLogP | -0.56 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|