C22H19F2N3O6 — CID 175492608
(3S)-3-[3-(2,4-difluorophenoxy)phenyl]-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid (PubChem CID 175492608) has the molecular formula C22H19F2N3O6 and a molecular weight of 459.41 g/mol. Its IUPAC name is (3S)-3-[3-(2,4-difluorophenoxy)phenyl]-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid.
| Compound Name | (3S)-3-[3-(2,4-difluorophenoxy)phenyl]-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 175492608 |
| Molecular Formula | C22H19F2N3O6 |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (3S)-3-[3-(2,4-difluorophenoxy)phenyl]-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
| SMILES | CN1C=CC(=O)C(NC(=O)N[C@@H](CC(=O)O)c2cccc(Oc3ccc(F)cc3F)c2)C1=O |
| InChI | InChI=1S/C22H19F2N3O6/c1-27-8-7-17(28)20(21(27)31)26-22(32)25-16(11-19(29)30)12-3-2-4-14(9-12)33-18-6-5-13(23)10-15(18)24/h2-10,16,20H,11H2,1H3,(H,29,30)(H2,25,26,32)/t16-,20?/m0/s1 |
| InChIKey | FUCPLAJEQDKPFZ-DJZRFWRSSA-N |
| XLogP | 2.50 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|