C22H20FN3O5 — CID 175563111
(3S)-3-(2-fluoro-5-phenylphenyl)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid (PubChem CID 175563111) has the molecular formula C22H20FN3O5 and a molecular weight of 425.42 g/mol. Its IUPAC name is (3S)-3-(2-fluoro-5-phenylphenyl)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid.
| Compound Name | (3S)-3-(2-fluoro-5-phenylphenyl)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 175563111 |
| Molecular Formula | C22H20FN3O5 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (3S)-3-(2-fluoro-5-phenylphenyl)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
| SMILES | CN1C=CC(=O)C(NC(=O)N[C@@H](CC(=O)O)c2cc(-c3ccccc3)ccc2F)C1=O |
| InChI | InChI=1S/C22H20FN3O5/c1-26-10-9-18(27)20(21(26)30)25-22(31)24-17(12-19(28)29)15-11-14(7-8-16(15)23)13-5-3-2-4-6-13/h2-11,17,20H,12H2,1H3,(H,28,29)(H2,24,25,31)/t17-,20?/m0/s1 |
| InChIKey | RWYSLHRUOXCUSO-DIMJTDRSSA-N |
| XLogP | 2.23 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|