C23H23N3O6 — CID 175002334
3-(3-methoxy-5-phenylphenyl)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid (PubChem CID 175002334) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is 3-(3-methoxy-5-phenylphenyl)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid.
| Compound Name | 3-(3-methoxy-5-phenylphenyl)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 175002334 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 3-(3-methoxy-5-phenylphenyl)-3-[(1-methyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
| SMILES | COc1cc(-c2ccccc2)cc(C(CC(=O)O)NC(=O)NC2C(=O)C=CN(C)C2=O)c1 |
| InChI | InChI=1S/C23H23N3O6/c1-26-9-8-19(27)21(22(26)30)25-23(31)24-18(13-20(28)29)16-10-15(11-17(12-16)32-2)14-6-4-3-5-7-14/h3-12,18,21H,13H2,1-2H3,(H,28,29)(H2,24,25,31) |
| InChIKey | DWPKEQDTZACPAM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|