C24H23N3O7 — CID 175562787
(3S)-3-[3-(1,3-benzodioxol-5-yl)phenyl]-3-[(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid (PubChem CID 175562787) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is (3S)-3-[3-(1,3-benzodioxol-5-yl)phenyl]-3-[(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid.
| Compound Name | (3S)-3-[3-(1,3-benzodioxol-5-yl)phenyl]-3-[(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 175562787 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (3S)-3-[3-(1,3-benzodioxol-5-yl)phenyl]-3-[(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoylamino]propanoic acid |
| SMILES | CC1=CN(C)C(=O)C(NC(=O)N[C@@H](CC(=O)O)c2cccc(-c3ccc4c(c3)OCO4)c2)C1=O |
| InChI | InChI=1S/C24H23N3O7/c1-13-11-27(2)23(31)21(22(13)30)26-24(32)25-17(10-20(28)29)16-5-3-4-14(8-16)15-6-7-18-19(9-15)34-12-33-18/h3-9,11,17,21H,10,12H2,1-2H3,(H,28,29)(H2,25,26,32)/t17-,21?/m0/s1 |
| InChIKey | RLODBNKULRLKOC-PBVYKCSPSA-N |
| XLogP | 2.21 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|