C17H21NO2S — CID 175002555
ethyl 3-amino-3-[5-(2,6-dimethylphenyl)thiophen-2-yl]propanoate (PubChem CID 175002555) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is ethyl 3-amino-3-[5-(2,6-dimethylphenyl)thiophen-2-yl]propanoate.
| Compound Name | ethyl 3-amino-3-[5-(2,6-dimethylphenyl)thiophen-2-yl]propanoate |
|---|---|
| PubChem CID | 175002555 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | ethyl 3-amino-3-[5-(2,6-dimethylphenyl)thiophen-2-yl]propanoate |
| SMILES | CCOC(=O)CC(N)c1ccc(-c2c(C)cccc2C)s1 |
| InChI | InChI=1S/C17H21NO2S/c1-4-20-16(19)10-13(18)14-8-9-15(21-14)17-11(2)6-5-7-12(17)3/h5-9,13H,4,10,18H2,1-3H3 |
| InChIKey | VPZYUUOIGAXFSZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |