C24H28NOP — CID 175003058
[(1S)-cyclohexa-2,4-dien-1-yl]-cyclohexa-2,4-dien-1-ylphosphane;2-phenyl-4-propan-2-yl-1,3-oxazole (PubChem CID 175003058) has the molecular formula C24H28NOP and a molecular weight of 377.47 g/mol. Its IUPAC name is [(1S)-cyclohexa-2,4-dien-1-yl]-cyclohexa-2,4-dien-1-ylphosphane;2-phenyl-4-propan-2-yl-1,3-oxazole.
| Compound Name | [(1S)-cyclohexa-2,4-dien-1-yl]-cyclohexa-2,4-dien-1-ylphosphane;2-phenyl-4-propan-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 175003058 |
| Molecular Formula | C24H28NOP |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [(1S)-cyclohexa-2,4-dien-1-yl]-cyclohexa-2,4-dien-1-ylphosphane;2-phenyl-4-propan-2-yl-1,3-oxazole |
| SMILES | C1=CCC(P[C@@H]2C=CC=CC2)C=C1.CC(C)c1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H13NO.C12H15P/c1-9(2)11-8-14-12(13-11)10-6-4-3-5-7-10;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h3-9H,1-2H3;1-7,9,11-13H,8,10H2/t;11-,12?/m.1/s1 |
| InChIKey | ATWLNXVWPCUAPS-XEVVMFMOSA-N |
| XLogP | 6.90 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|